C21H35NO3Si — CID 45037028
tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-phenylpyrrolidine-1-carboxylate (PubChem CID 45037028) has the molecular formula C21H35NO3Si and a molecular weight of 377.60 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 45037028 |
| Molecular Formula | C21H35NO3Si |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | tert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H35NO3Si/c1-20(2,3)24-19(23)22-15-17(25-26(7,8)21(4,5)6)14-18(22)16-12-10-9-11-13-16/h9-13,17-18H,14-15H2,1-8H3/t17-,18-/m0/s1 |
| InChIKey | RFWNCJXLIVDXKF-ROUUACIJSA-N |
| XLogP | 5.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|