C26H43NO4Si — CID 134962336
tert-butyl N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl]-N-[(2S)-1-phenylmethoxybut-3-en-2-yl]carbamate (PubChem CID 134962336) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is tert-butyl N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl]-N-[(2S)-1-phenylmethoxybut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl]-N-[(2S)-1-phenylmethoxybut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134962336 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | tert-butyl N-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enyl]-N-[(2S)-1-phenylmethoxybut-3-en-2-yl]carbamate |
| SMILES | C=C[C@@H](COCc1ccccc1)N(CC(=C)CO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H43NO4Si/c1-11-23(20-29-19-22-15-13-12-14-16-22)27(24(28)31-25(3,4)5)17-21(2)18-30-32(9,10)26(6,7)8/h11-16,23H,1-2,17-20H2,3-10H3/t23-/m0/s1 |
| InChIKey | XLJYOGYEOQCXIV-QHCPKHFHSA-N |
| XLogP | 6.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|