C20H27NO3 — CID 11782453
N-benzyl-N-[(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide (PubChem CID 11782453) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide.
| Compound Name | N-benzyl-N-[(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide |
|---|---|
| PubChem CID | 11782453 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-benzyl-N-[(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]acetamide |
| SMILES | C=CC[C@@H]([C@@H]1OC(C)(C)O[C@@H]1C=C)N(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C20H27NO3/c1-6-11-17(19-18(7-2)23-20(4,5)24-19)21(15(3)22)14-16-12-9-8-10-13-16/h6-10,12-13,17-19H,1-2,11,14H2,3-5H3/t17-,18+,19-/m0/s1 |
| InChIKey | QGAOAXIJOYTDBK-OTWHNJEPSA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|