C20H22F3NO3 — CID 11090226
N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzyl-2,2,2-trifluoroacetamide (PubChem CID 11090226) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzyl-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzyl-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11090226 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[(3aS,4S,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]-N-benzyl-2,2,2-trifluoroacetamide |
| SMILES | C=CC1=C[C@H]2OC(C)(C)O[C@H]2[C@@H](N(Cc2ccccc2)C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C20H22F3NO3/c1-4-13-10-15(17-16(11-13)26-19(2,3)27-17)24(18(25)20(21,22)23)12-14-8-6-5-7-9-14/h4-9,11,15-17H,1,10,12H2,2-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | LHIFPYHOEQEHRE-BBWFWOEESA-N |
| XLogP | 3.98 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |