C18H21F2NO3 — CID 166415626
N-[(2,5-difluorophenyl)methyl]-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)prop-2-enamide (PubChem CID 166415626) has the molecular formula C18H21F2NO3 and a molecular weight of 337.37 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)prop-2-enamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 166415626 |
| Molecular Formula | C18H21F2NO3 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cc(F)ccc1F)CC1COC2(CCCC2)O1 |
| InChI | InChI=1S/C18H21F2NO3/c1-2-17(22)21(10-13-9-14(19)5-6-16(13)20)11-15-12-23-18(24-15)7-3-4-8-18/h2,5-6,9,15H,1,3-4,7-8,10-12H2 |
| InChIKey | QZACCEQYNLWMHJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|