C19H21F6NO3 — CID 11711563
N-benzyl-N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-enyl]-2,2,2-trifluoroacetamide (PubChem CID 11711563) has the molecular formula C19H21F6NO3 and a molecular weight of 425.37 g/mol. Its IUPAC name is N-benzyl-N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-enyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-benzyl-N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-enyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11711563 |
| Molecular Formula | C19H21F6NO3 |
| Molecular Weight | 425.37 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-benzyl-N-[(1R,2S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(trifluoromethyl)but-3-enyl]-2,2,2-trifluoroacetamide |
| SMILES | C=C[C@@H]([C@H]([C@H]1COC(C)(C)O1)N(Cc1ccccc1)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H21F6NO3/c1-4-13(18(20,21)22)15(14-11-28-17(2,3)29-14)26(16(27)19(23,24)25)10-12-8-6-5-7-9-12/h4-9,13-15H,1,10-11H2,2-3H3/t13-,14+,15+/m0/s1 |
| InChIKey | NDAOAVDHPCSOFF-RRFJBIMHSA-N |
| XLogP | 4.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.37 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|