C19H23F4NO5 — CID 139178093
(2R)-N-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-N-benzyl-2,3,3,3-tetrafluoropropanamide (PubChem CID 139178093) has the molecular formula C19H23F4NO5 and a molecular weight of 421.39 g/mol. Its IUPAC name is (2R)-N-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-N-benzyl-2,3,3,3-tetrafluoropropanamide.
| Compound Name | (2R)-N-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-N-benzyl-2,3,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 139178093 |
| Molecular Formula | C19H23F4NO5 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (2R)-N-[[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl]-N-benzyl-2,3,3,3-tetrafluoropropanamide |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CN(Cc1ccccc1)C(=O)[C@@H](F)C(F)(F)F |
| InChI | InChI=1S/C19H23F4NO5/c1-18(2)28-14-13(26-3)12(27-17(14)29-18)10-24(9-11-7-5-4-6-8-11)16(25)15(20)19(21,22)23/h4-8,12-15,17H,9-10H2,1-3H3/t12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | ALDOMYALBDGPEZ-JRBZFYFNSA-N |
| XLogP | 2.81 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |