C16H22NO5- — CID 102355016
1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N-benzyl-N-oxidomethanamine (PubChem CID 102355016) has the molecular formula C16H22NO5- and a molecular weight of 308.35 g/mol. Its IUPAC name is 1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N-benzyl-N-oxidomethanamine.
| Compound Name | 1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N-benzyl-N-oxidomethanamine |
|---|---|
| PubChem CID | 102355016 |
| Molecular Formula | C16H22NO5- |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-N-benzyl-N-oxidomethanamine |
| SMILES | CO[C@H]1O[C@H](CN([O-])Cc2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H22NO5/c1-16(2)21-13-12(20-15(19-3)14(13)22-16)10-17(18)9-11-7-5-4-6-8-11/h4-8,12-15H,9-10H2,1-3H3/q-1/t12-,13+,14+,15+/m1/s1 |
| InChIKey | DMXXXLYMVDENID-QPSCCSFWSA-N |
| XLogP | 1.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|