C20H22F3NO3 — CID 102271372
N-benzyl-N-[(1S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 102271372) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-benzyl-N-[(1S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-benzyl-N-[(1S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 102271372 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-benzyl-N-[(1S)-1-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | C#CC[C@@H]([C@H]1OC(C)(C)O[C@@H]1C=C)N(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H22F3NO3/c1-5-10-15(17-16(6-2)26-19(3,4)27-17)24(18(25)20(21,22)23)13-14-11-8-7-9-12-14/h1,6-9,11-12,15-17H,2,10,13H2,3-4H3/t15-,16+,17+/m0/s1 |
| InChIKey | WSPQBBCTYLXJDH-GVDBMIGSSA-N |
| XLogP | 3.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|