C16H18F3NO2 — CID 23729624
(1S)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trifluorobut-2-yn-1-amine (PubChem CID 23729624) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is (1S)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trifluorobut-2-yn-1-amine.
| Compound Name | (1S)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trifluorobut-2-yn-1-amine |
|---|---|
| PubChem CID | 23729624 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (1S)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4,4-trifluorobut-2-yn-1-amine |
| SMILES | CC1(C)OC[C@H]([C@H](C#CC(F)(F)F)NCc2ccccc2)O1 |
| InChI | InChI=1S/C16H18F3NO2/c1-15(2)21-11-14(22-15)13(8-9-16(17,18)19)20-10-12-6-4-3-5-7-12/h3-7,13-14,20H,10-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | KRWXPSXPSZWDPV-UONOGXRCSA-N |
| XLogP | 2.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|