C20H24F3NO4 — CID 11372952
1-[(3aS,4S,6aR)-2,2-dimethyl-4-[(E)-4-phenylmethoxybut-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 11372952) has the molecular formula C20H24F3NO4 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[(3aS,4S,6aR)-2,2-dimethyl-4-[(E)-4-phenylmethoxybut-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3aS,4S,6aR)-2,2-dimethyl-4-[(E)-4-phenylmethoxybut-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 11372952 |
| Molecular Formula | C20H24F3NO4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 1-[(3aS,4S,6aR)-2,2-dimethyl-4-[(E)-4-phenylmethoxybut-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN(C(=O)C(F)(F)F)[C@H]2/C=C/CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C20H24F3NO4/c1-19(2)27-16-12-24(18(25)20(21,22)23)15(17(16)28-19)10-6-7-11-26-13-14-8-4-3-5-9-14/h3-6,8-10,15-17H,7,11-13H2,1-2H3/b10-6+/t15-,16+,17-/m0/s1 |
| InChIKey | CBNAZWWNNOPFFB-CQHHLICSSA-N |
| XLogP | 3.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|