C23H37NO3Si — CID 101074075
(3aS,4S,8aS)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-amine (PubChem CID 101074075) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is (3aS,4S,8aS)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-amine.
| Compound Name | (3aS,4S,8aS)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-amine |
|---|---|
| PubChem CID | 101074075 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (3aS,4S,8aS)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,5,6,8a-tetrahydro-3aH-cyclohepta[d][1,3]dioxol-5-amine |
| SMILES | CC1(C)O[C@H]2[C@H](C=CCC(NCc3ccccc3)[C@@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H37NO3Si/c1-22(2,3)28(6,7)27-20-18(24-16-17-12-9-8-10-13-17)14-11-15-19-21(20)26-23(4,5)25-19/h8-13,15,18-21,24H,14,16H2,1-7H3/t18?,19-,20-,21-/m0/s1 |
| InChIKey | ZWQCELPHALRUCQ-KTYMLHDXSA-N |
| XLogP | 5.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|