C24H41NO4Si — CID 135029149
(1R)-1-[(4S,5R)-5-[(1R)-1-(benzylamino)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol (PubChem CID 135029149) has the molecular formula C24H41NO4Si and a molecular weight of 435.68 g/mol. Its IUPAC name is (1R)-1-[(4S,5R)-5-[(1R)-1-(benzylamino)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol.
| Compound Name | (1R)-1-[(4S,5R)-5-[(1R)-1-(benzylamino)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 135029149 |
| Molecular Formula | C24H41NO4Si |
| Molecular Weight | 435.68 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | (1R)-1-[(4S,5R)-5-[(1R)-1-(benzylamino)but-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
| SMILES | C=CC[C@@H](NCc1ccccc1)[C@H]1OC(C)(C)O[C@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41NO4Si/c1-9-13-19(25-16-18-14-11-10-12-15-18)21-22(29-24(5,6)28-21)20(26)17-27-30(7,8)23(2,3)4/h9-12,14-15,19-22,25-26H,1,13,16-17H2,2-8H3/t19-,20-,21-,22+/m1/s1 |
| InChIKey | NBSFWYNPBUQIQT-YSFYHYPLSA-N |
| XLogP | 4.62 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|