C23H38N2O3 — CID 11111933
(1S,2S,3R,4R)-3-amino-2-[benzyl(tert-butyl)amino]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-5-en-1-ol (PubChem CID 11111933) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-amino-2-[benzyl(tert-butyl)amino]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-5-en-1-ol.
| Compound Name | (1S,2S,3R,4R)-3-amino-2-[benzyl(tert-butyl)amino]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-5-en-1-ol |
|---|---|
| PubChem CID | 11111933 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (1S,2S,3R,4R)-3-amino-2-[benzyl(tert-butyl)amino]-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-5-en-1-ol |
| SMILES | C=C[C@@H](C)[C@@H](N)[C@@H]([C@H](O)[C@H]1COC(C)(C)O1)N(Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H38N2O3/c1-8-16(2)19(24)20(21(26)18-15-27-23(6,7)28-18)25(22(3,4)5)14-17-12-10-9-11-13-17/h8-13,16,18-21,26H,1,14-15,24H2,2-7H3/t16-,18-,19-,20+,21-/m1/s1 |
| InChIKey | FLZDSGSKRCVVAT-LELZANKISA-N |
| XLogP | 3.32 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|