C18H25NO3 — CID 166449239
(1R)-1-[(4R,5R)-5-[(1R)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol (PubChem CID 166449239) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (1R)-1-[(4R,5R)-5-[(1R)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(4R,5R)-5-[(1R)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 166449239 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (1R)-1-[(4R,5R)-5-[(1R)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@@H](C=C)NCc1ccccc1 |
| InChI | InChI=1S/C18H25NO3/c1-5-14(19-12-13-10-8-7-9-11-13)16-17(15(20)6-2)22-18(3,4)21-16/h5-11,14-17,19-20H,1-2,12H2,3-4H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | YXZQUDNTAOEFBR-QBPKDAKJSA-N |
| XLogP | 2.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|