C24H31NO3 — CID 134971945
(1S,2R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine (PubChem CID 134971945) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (1S,2R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine.
| Compound Name | (1S,2R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine |
|---|---|
| PubChem CID | 134971945 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (1S,2R)-N-benzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylmethoxypent-4-en-2-amine |
| SMILES | C=CC[C@@H](NCc1ccccc1)[C@H](OCc1ccccc1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H31NO3/c1-4-11-21(25-16-19-12-7-5-8-13-19)23(22-18-27-24(2,3)28-22)26-17-20-14-9-6-10-15-20/h4-10,12-15,21-23,25H,1,11,16-18H2,2-3H3/t21-,22+,23+/m1/s1 |
| InChIKey | AJYUOGLVQOWCNI-VJBWXMMDSA-N |
| XLogP | 4.46 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|