C25H41NO5Si — CID 134836303
(E,4S,5S)-4-[benzyl(methyl)amino]-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxypent-2-enal (PubChem CID 134836303) has the molecular formula C25H41NO5Si and a molecular weight of 463.69 g/mol. Its IUPAC name is (E,4S,5S)-4-[benzyl(methyl)amino]-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxypent-2-enal.
| Compound Name | (E,4S,5S)-4-[benzyl(methyl)amino]-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxypent-2-enal |
|---|---|
| PubChem CID | 134836303 |
| Molecular Formula | C25H41NO5Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (E,4S,5S)-4-[benzyl(methyl)amino]-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxypent-2-enal |
| SMILES | CO/C(=C/C=O)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H41NO5Si/c1-24(2,3)32(8,9)31-23(21-18-29-25(4,5)30-21)22(20(28-7)15-16-27)26(6)17-19-13-11-10-12-14-19/h10-16,21-23H,17-18H2,1-9H3/b20-15+/t21-,22-,23-/m1/s1 |
| InChIKey | RQJMKFGJCXJVEP-GKUFZVHOSA-N |
| XLogP | 4.76 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|