C26H43NO4Si — CID 135062071
N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-ethoxyprop-2-en-1-amine (PubChem CID 135062071) has the molecular formula C26H43NO4Si and a molecular weight of 461.72 g/mol. Its IUPAC name is N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-ethoxyprop-2-en-1-amine.
| Compound Name | N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-ethoxyprop-2-en-1-amine |
|---|---|
| PubChem CID | 135062071 |
| Molecular Formula | C26H43NO4Si |
| Molecular Weight | 461.72 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2-ethoxyprop-2-en-1-amine |
| SMILES | C=C(OCC)C([C@H]1COC2(CCCCC2)O1)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H43NO4Si/c1-8-28-21(2)24(23-20-29-26(30-23)17-13-10-14-18-26)27(19-22-15-11-9-12-16-22)31-32(6,7)25(3,4)5/h9,11-12,15-16,23-24H,2,8,10,13-14,17-20H2,1,3-7H3/t23-,24?/m1/s1 |
| InChIKey | GBZAKVMDNJADLV-MIHMCVIASA-N |
| XLogP | 6.42 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|