C18H25NO4 — CID 134836025
(E,4S)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal (PubChem CID 134836025) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (E,4S)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal.
| Compound Name | (E,4S)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal |
|---|---|
| PubChem CID | 134836025 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (E,4S)-4-[benzyl(methyl)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxybut-2-enal |
| SMILES | CO/C(=C/C=O)[C@H]([C@H]1COC(C)(C)O1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H25NO4/c1-18(2)22-13-16(23-18)17(15(21-4)10-11-20)19(3)12-14-8-6-5-7-9-14/h5-11,16-17H,12-13H2,1-4H3/b15-10+/t16-,17-/m1/s1 |
| InChIKey | KRFDEEWSMIVFRH-QYHCQRMFSA-N |
| XLogP | 2.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|