C21H33NO4Si — CID 72752641
2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane (PubChem CID 72752641) has the molecular formula C21H33NO4Si and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 72752641 |
| Molecular Formula | C21H33NO4Si |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 2-[[2-benzyl-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,6-dihydrooxazin-4-yl]oxy]ethyl-trimethylsilane |
| SMILES | CC1(C)OCC(C2C(OCC[Si](C)(C)C)=CCON2Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H33NO4Si/c1-21(2)24-16-19(26-21)20-18(23-13-14-27(3,4)5)11-12-25-22(20)15-17-9-7-6-8-10-17/h6-11,19-20H,12-16H2,1-5H3 |
| InChIKey | YOFZFJKKRFYGCS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|