C25H41NO6Si — CID 11049102
tert-butyl N-benzyl-N-[(2R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methoxyoxan-4-yl]carbamate (PubChem CID 11049102) has the molecular formula C25H41NO6Si and a molecular weight of 479.69 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(2R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methoxyoxan-4-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(2R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methoxyoxan-4-yl]carbamate |
|---|---|
| PubChem CID | 11049102 |
| Molecular Formula | C25H41NO6Si |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | tert-butyl N-benzyl-N-[(2R,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-formyl-2-methoxyoxan-4-yl]carbamate |
| SMILES | CO[C@]1(C=O)C[C@@H](N(Cc2ccccc2)C(=O)OC(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)CO1 |
| InChI | InChI=1S/C25H41NO6Si/c1-23(2,3)31-22(28)26(16-19-13-11-10-12-14-19)20-15-25(18-27,29-7)30-17-21(20)32-33(8,9)24(4,5)6/h10-14,18,20-21H,15-17H2,1-9H3/t20-,21-,25-/m1/s1 |
| InChIKey | ARVGNOOVDWAFTE-DNRQZRRGSA-N |
| XLogP | 5.14 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|