C21H31NO5Si — CID 10644994
(2S,5R)-9-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dioxa-9-azaspiro[4.5]decane-7,10-dione (PubChem CID 10644994) has the molecular formula C21H31NO5Si and a molecular weight of 405.57 g/mol. Its IUPAC name is (2S,5R)-9-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dioxa-9-azaspiro[4.5]decane-7,10-dione.
| Compound Name | (2S,5R)-9-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dioxa-9-azaspiro[4.5]decane-7,10-dione |
|---|---|
| PubChem CID | 10644994 |
| Molecular Formula | C21H31NO5Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (2S,5R)-9-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,6-dioxa-9-azaspiro[4.5]decane-7,10-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC[C@]2(OC(=O)CN(Cc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C21H31NO5Si/c1-20(2,3)28(4,5)25-15-17-11-12-21(26-17)19(24)22(14-18(23)27-21)13-16-9-7-6-8-10-16/h6-10,17H,11-15H2,1-5H3/t17-,21+/m0/s1 |
| InChIKey | CSVDIEKQLKLKQQ-LAUBAEHRSA-N |
| XLogP | 3.47 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|