C21H32N2O4Si — CID 10597384
(2S,5S)-7-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione (PubChem CID 10597384) has the molecular formula C21H32N2O4Si and a molecular weight of 404.58 g/mol. Its IUPAC name is (2S,5S)-7-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione.
| Compound Name | (2S,5S)-7-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione |
|---|---|
| PubChem CID | 10597384 |
| Molecular Formula | C21H32N2O4Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (2S,5S)-7-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-oxa-7,10-diazaspiro[4.5]decane-6,9-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC[C@]2(NC(=O)CN(Cc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C21H32N2O4Si/c1-20(2,3)28(4,5)26-15-17-11-12-21(27-17)19(25)23(14-18(24)22-21)13-16-9-7-6-8-10-16/h6-10,17H,11-15H2,1-5H3,(H,22,24)/t17-,21-/m0/s1 |
| InChIKey | BPNVJKZJHAYJAW-UWJYYQICSA-N |
| XLogP | 3.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|