C21H34N2O5Si — CID 10669941
(5S)-N-(2-amino-2-oxoethyl)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxyoxolane-2-carboxamide (PubChem CID 10669941) has the molecular formula C21H34N2O5Si and a molecular weight of 422.60 g/mol. Its IUPAC name is (5S)-N-(2-amino-2-oxoethyl)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxyoxolane-2-carboxamide.
| Compound Name | (5S)-N-(2-amino-2-oxoethyl)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 10669941 |
| Molecular Formula | C21H34N2O5Si |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (5S)-N-(2-amino-2-oxoethyl)-N-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-hydroxyoxolane-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC(O)(C(=O)N(CC(N)=O)Cc2ccccc2)O1 |
| InChI | InChI=1S/C21H34N2O5Si/c1-20(2,3)29(4,5)27-15-17-11-12-21(26,28-17)19(25)23(14-18(22)24)13-16-9-7-6-8-10-16/h6-10,17,26H,11-15H2,1-5H3,(H2,22,24)/t17-,21?/m0/s1 |
| InChIKey | HJGHWDXGWCHLPM-PBVYKCSPSA-N |
| XLogP | 2.39 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|