C16H21NO4 — CID 134839173
(3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one (PubChem CID 134839173) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one.
| Compound Name | (3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one |
|---|---|
| PubChem CID | 134839173 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2C(=O)CCON2Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H21NO4/c1-16(2)19-11-14(21-16)15-13(18)8-9-20-17(15)10-12-6-4-3-5-7-12/h3-7,14-15H,8-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | OPSSAWVUORPILG-CABCVRRESA-N |
| XLogP | 1.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |