C16H20BrNO4 — CID 11406044
(3R,5R)-2-benzyl-5-bromo-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one (PubChem CID 11406044) has the molecular formula C16H20BrNO4 and a molecular weight of 370.24 g/mol. Its IUPAC name is (3R,5R)-2-benzyl-5-bromo-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one.
| Compound Name | (3R,5R)-2-benzyl-5-bromo-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one |
|---|---|
| PubChem CID | 11406044 |
| Molecular Formula | C16H20BrNO4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | (3R,5R)-2-benzyl-5-bromo-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one |
| SMILES | CC1(C)OC[C@H]([C@@H]2C(=O)[C@H](Br)CON2Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H20BrNO4/c1-16(2)20-10-13(22-16)14-15(19)12(17)9-21-18(14)8-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13-,14-/m1/s1 |
| InChIKey | YIRDBEHHRJCQMU-MGPQQGTHSA-N |
| XLogP | 2.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|