C16H20N4O4 — CID 101166455
(3S,5R)-5-azido-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one (PubChem CID 101166455) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is (3S,5R)-5-azido-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one.
| Compound Name | (3S,5R)-5-azido-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one |
|---|---|
| PubChem CID | 101166455 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (3S,5R)-5-azido-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]oxazinan-4-one |
| SMILES | CC1(C)OC[C@H]([C@H]2C(=O)[C@H](N=[N+]=[N-])CON2Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H20N4O4/c1-16(2)22-10-13(24-16)14-15(21)12(18-19-17)9-23-20(14)8-11-6-4-3-5-7-11/h3-7,12-14H,8-10H2,1-2H3/t12-,13-,14+/m1/s1 |
| InChIKey | ZOVYGGDUGAVICY-MCIONIFRSA-N |
| XLogP | 2.20 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|