C28H41NO5Si — CID 134924753
methyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 134924753) has the molecular formula C28H41NO5Si and a molecular weight of 499.72 g/mol. Its IUPAC name is methyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | methyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 134924753 |
| Molecular Formula | C28H41NO5Si |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | methyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | COC(=O)CC([C@H]1COC(C)(C)O1)N(O[Si](C)(C)C(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H41NO5Si/c1-27(2,3)35(7,8)34-29(23(19-25(30)31-6)24-20-32-28(4,5)33-24)26(21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-24,26H,19-20H2,1-8H3/t23?,24-/m1/s1 |
| InChIKey | WCNNGRARVFVJHW-XMMISQBUSA-N |
| XLogP | 6.10 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|