C28H33NO3Si — CID 11015977
(4S,5S)-4-(benzylamino)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one (PubChem CID 11015977) has the molecular formula C28H33NO3Si and a molecular weight of 459.66 g/mol. Its IUPAC name is (4S,5S)-4-(benzylamino)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one.
| Compound Name | (4S,5S)-4-(benzylamino)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 11015977 |
| Molecular Formula | C28H33NO3Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (4S,5S)-4-(benzylamino)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(=O)C[C@@H]1NCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33NO3Si/c1-28(2,3)33(23-15-9-5-10-16-23,24-17-11-6-12-18-24)31-21-26-25(19-27(30)32-26)29-20-22-13-7-4-8-14-22/h4-18,25-26,29H,19-21H2,1-3H3/t25-,26+/m0/s1 |
| InChIKey | WMNYIIGUEKLPLW-IZZNHLLZSA-N |
| XLogP | 4.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|