C24H45NO4Si2 — CID 134871814
(3R,4R)-3-(benzylazaniumyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate (PubChem CID 134871814) has the molecular formula C24H45NO4Si2 and a molecular weight of 467.80 g/mol. Its IUPAC name is (3R,4R)-3-(benzylazaniumyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate.
| Compound Name | (3R,4R)-3-(benzylazaniumyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate |
|---|---|
| PubChem CID | 134871814 |
| Molecular Formula | C24H45NO4Si2 |
| Molecular Weight | 467.80 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (3R,4R)-3-(benzylazaniumyl)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CC(=O)[O-])[NH2+]Cc1ccccc1 |
| InChI | InChI=1S/C24H45NO4Si2/c1-23(2,3)30(7,8)28-18-21(29-31(9,10)24(4,5)6)20(16-22(26)27)25-17-19-14-12-11-13-15-19/h11-15,20-21,25H,16-18H2,1-10H3,(H,26,27)/t20-,21+/m1/s1 |
| InChIKey | KCJJPLBHIHDPHG-RTWAWAEBSA-N |
| XLogP | 3.67 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.80 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|