C20H35NO3Si — CID 10546819
methyl (2S,3R)-2-[(1S)-1-(benzylamino)ethyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate (PubChem CID 10546819) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is methyl (2S,3R)-2-[(1S)-1-(benzylamino)ethyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate.
| Compound Name | methyl (2S,3R)-2-[(1S)-1-(benzylamino)ethyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 10546819 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | methyl (2S,3R)-2-[(1S)-1-(benzylamino)ethyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
| SMILES | COC(=O)[C@@H]([C@H](C)NCc1ccccc1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H35NO3Si/c1-15(21-14-17-12-10-9-11-13-17)18(19(22)23-6)16(2)24-25(7,8)20(3,4)5/h9-13,15-16,18,21H,14H2,1-8H3/t15-,16+,18-/m0/s1 |
| InChIKey | XPRXKGWMNILLAV-JZXOWHBKSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|