C22H37NO3Si — CID 53341640
[(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-1-phenylethyl]amino]hex-4-enyl] acetate (PubChem CID 53341640) has the molecular formula C22H37NO3Si and a molecular weight of 391.63 g/mol. Its IUPAC name is [(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-1-phenylethyl]amino]hex-4-enyl] acetate.
| Compound Name | [(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-1-phenylethyl]amino]hex-4-enyl] acetate |
|---|---|
| PubChem CID | 53341640 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [(E,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[[(1R)-1-phenylethyl]amino]hex-4-enyl] acetate |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](COC(C)=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO3Si/c1-9-13-21(26-27(7,8)22(4,5)6)20(16-25-18(3)24)23-17(2)19-14-11-10-12-15-19/h9-15,17,20-21,23H,16H2,1-8H3/b13-9+/t17-,20+,21+/m1/s1 |
| InChIKey | DTXSENQMEFMVPZ-FRRFLFBKSA-N |
| XLogP | 5.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|