C28H53NO4Si2 — CID 46845308
[(2S,3R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[(1R)-1-phenylethyl]amino]hexyl] acetate (PubChem CID 46845308) has the molecular formula C28H53NO4Si2 and a molecular weight of 523.91 g/mol. Its IUPAC name is [(2S,3R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[(1R)-1-phenylethyl]amino]hexyl] acetate.
| Compound Name | [(2S,3R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[(1R)-1-phenylethyl]amino]hexyl] acetate |
|---|---|
| PubChem CID | 46845308 |
| Molecular Formula | C28H53NO4Si2 |
| Molecular Weight | 523.91 g/mol |
| Exact Mass | 523.35 |
| IUPAC Name | [(2S,3R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[(1R)-1-phenylethyl]amino]hexyl] acetate |
| SMILES | CC(=O)OC[C@H](N[C@H](C)c1ccccc1)[C@@H](CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H53NO4Si2/c1-22(24-17-14-13-15-18-24)29-25(21-31-23(2)30)26(33-35(11,12)28(6,7)8)19-16-20-32-34(9,10)27(3,4)5/h13-15,17-18,22,25-26,29H,16,19-21H2,1-12H3/t22-,25+,26-/m1/s1 |
| InChIKey | HFSDJGLZUDPNJT-ZSQFBXSQSA-N |
| XLogP | 7.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.91 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|