C19H24FNO7 — CID 132821865
[(2R,3S,4R,5R)-3,4-diacetyloxy-5-(benzylamino)-6-fluorooxan-2-yl]methyl acetate (PubChem CID 132821865) has the molecular formula C19H24FNO7 and a molecular weight of 397.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(benzylamino)-6-fluorooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(benzylamino)-6-fluorooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132821865 |
| Molecular Formula | C19H24FNO7 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-5-(benzylamino)-6-fluorooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(F)[C@H](NCc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H24FNO7/c1-11(22)25-10-15-17(26-12(2)23)18(27-13(3)24)16(19(20)28-15)21-9-14-7-5-4-6-8-14/h4-8,15-19,21H,9-10H2,1-3H3/t15-,16-,17-,18-,19?/m1/s1 |
| InChIKey | OFDCAQCIVMWRIT-XTHKVDEBSA-N |
| XLogP | 1.27 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|