C23H36NO6+ — CID 3012864
[(2R,3R,4R,5R)-1-benzyl-4-(2,2-dimethylpropanoyloxy)-3,5-dihydroxypiperidin-1-ium-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 3012864) has the molecular formula C23H36NO6+ and a molecular weight of 422.54 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-1-benzyl-4-(2,2-dimethylpropanoyloxy)-3,5-dihydroxypiperidin-1-ium-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-1-benzyl-4-(2,2-dimethylpropanoyloxy)-3,5-dihydroxypiperidin-1-ium-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 3012864 |
| Molecular Formula | C23H36NO6+ |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | [(2R,3R,4R,5R)-1-benzyl-4-(2,2-dimethylpropanoyloxy)-3,5-dihydroxypiperidin-1-ium-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@@H]1[C@@H](O)[C@H](OC(=O)C(C)(C)C)[C@H](O)C[NH+]1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO6/c1-22(2,3)20(27)29-14-16-18(26)19(30-21(28)23(4,5)6)17(25)13-24(16)12-15-10-8-7-9-11-15/h7-11,16-19,25-26H,12-14H2,1-6H3/p+1/t16-,17-,18-,19-/m1/s1 |
| InChIKey | ZZUFSPPYTPVQCC-NCXUSEDFSA-O |
| XLogP | 0.72 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |