C36H55NO9 — CID 134971941
[(3S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-phenylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 134971941) has the molecular formula C36H55NO9 and a molecular weight of 645.83 g/mol. Its IUPAC name is [(3S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-phenylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-phenylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134971941 |
| Molecular Formula | C36H55NO9 |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.39 |
| IUPAC Name | [(3S,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(1S)-1-phenylbut-3-enyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H](N[C@@H]1OC(COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C36H55NO9/c1-14-18-23(22-19-16-15-17-20-22)37-28-27(46-32(41)36(11,12)13)26(45-31(40)35(8,9)10)25(44-30(39)34(5,6)7)24(43-28)21-42-29(38)33(2,3)4/h14-17,19-20,23-28,37H,1,18,21H2,2-13H3/t23-,24?,25-,26?,27?,28+/m0/s1 |
| InChIKey | LCBMZNSMIISXPB-JMAJILNNSA-N |
| XLogP | 6.08 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|