C34H50N2O9 — CID 14841391
[(2R,3S,4S,5R,6R)-6-[[(S)-cyano(phenyl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 14841391) has the molecular formula C34H50N2O9 and a molecular weight of 630.78 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[[(S)-cyano(phenyl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[[(S)-cyano(phenyl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14841391 |
| Molecular Formula | C34H50N2O9 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[[(S)-cyano(phenyl)methyl]amino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](N[C@H](C#N)c2ccccc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H50N2O9/c1-31(2,3)27(37)41-19-22-23(43-28(38)32(4,5)6)24(44-29(39)33(7,8)9)25(45-30(40)34(10,11)12)26(42-22)36-21(18-35)20-16-14-13-15-17-20/h13-17,21-26,36H,19H2,1-12H3/t21-,22-,23+,24+,25-,26-/m1/s1 |
| InChIKey | QNGFHWHEAXLYEB-PSRUHSIGSA-N |
| XLogP | 5.03 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|