C39H59NO11 — CID 134837013
ethyl (E,5S)-5-phenyl-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate (PubChem CID 134837013) has the molecular formula C39H59NO11 and a molecular weight of 717.90 g/mol. Its IUPAC name is ethyl (E,5S)-5-phenyl-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate.
| Compound Name | ethyl (E,5S)-5-phenyl-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 134837013 |
| Molecular Formula | C39H59NO11 |
| Molecular Weight | 717.90 g/mol |
| Exact Mass | 717.41 |
| IUPAC Name | ethyl (E,5S)-5-phenyl-5-[[(2R,5S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]amino]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](N[C@@H]1OC(COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C39H59NO11/c1-14-46-27(41)22-18-21-25(24-19-16-15-17-20-24)40-31-30(51-35(45)39(11,12)13)29(50-34(44)38(8,9)10)28(49-33(43)37(5,6)7)26(48-31)23-47-32(42)36(2,3)4/h15-20,22,25-26,28-31,40H,14,21,23H2,1-13H3/b22-18+/t25-,26?,28-,29?,30?,31+/m0/s1 |
| InChIKey | WVVYIAPJFPULHD-YQBGPOOYSA-N |
| XLogP | 6.01 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.90 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|