C22H26F3NO8 — CID 101090809
[(2R,3R,4R,5S,6R)-3,4-diacetyloxy-6-(2-phenylethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 101090809) has the molecular formula C22H26F3NO8 and a molecular weight of 489.44 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4-diacetyloxy-6-(2-phenylethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4-diacetyloxy-6-(2-phenylethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101090809 |
| Molecular Formula | C22H26F3NO8 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4-diacetyloxy-6-(2-phenylethyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](CCc2ccccc2)[C@H](NC(=O)C(F)(F)F)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H26F3NO8/c1-12(27)31-11-17-19(32-13(2)28)20(33-14(3)29)18(26-21(30)22(23,24)25)16(34-17)10-9-15-7-5-4-6-8-15/h4-8,16-20H,9-11H2,1-3H3,(H,26,30)/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | MAKXTONRLIFUNL-SWBPCFCJSA-N |
| XLogP | 1.86 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|