C28H44F3NO7 — CID 159843223
2-[[(2S,3R,4S,5R)-4-methoxy-2-nonyl-5-(3-phenylpropoxy)oxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 159843223) has the molecular formula C28H44F3NO7 and a molecular weight of 563.65 g/mol. Its IUPAC name is 2-[[(2S,3R,4S,5R)-4-methoxy-2-nonyl-5-(3-phenylpropoxy)oxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(2S,3R,4S,5R)-4-methoxy-2-nonyl-5-(3-phenylpropoxy)oxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159843223 |
| Molecular Formula | C28H44F3NO7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.31 |
| IUPAC Name | 2-[[(2S,3R,4S,5R)-4-methoxy-2-nonyl-5-(3-phenylpropoxy)oxan-3-yl]amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCC[C@@H]1OC[C@@H](OCCCc2ccccc2)[C@@H](OC)[C@@H]1NCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H43NO5.C2HF3O2/c1-3-4-5-6-7-8-12-17-22-25(27-19-24(28)29)26(30-2)23(20-32-22)31-18-13-16-21-14-10-9-11-15-21;3-2(4,5)1(6)7/h9-11,14-15,22-23,25-27H,3-8,12-13,16-20H2,1-2H3,(H,28,29);(H,6,7)/t22-,23+,25+,26+;/m0./s1 |
| InChIKey | QQGJBOUDNVLRRY-DUSMGPJASA-N |
| XLogP | 5.24 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|