C16H24F3NO2Si — CID 10831525
[(1R,2R)-2-phenyl-2-(propylamino)-1-trimethylsilylethyl] 2,2,2-trifluoroacetate (PubChem CID 10831525) has the molecular formula C16H24F3NO2Si and a molecular weight of 347.45 g/mol. Its IUPAC name is [(1R,2R)-2-phenyl-2-(propylamino)-1-trimethylsilylethyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2R)-2-phenyl-2-(propylamino)-1-trimethylsilylethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10831525 |
| Molecular Formula | C16H24F3NO2Si |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [(1R,2R)-2-phenyl-2-(propylamino)-1-trimethylsilylethyl] 2,2,2-trifluoroacetate |
| SMILES | CCCN[C@H](c1ccccc1)[C@H](OC(=O)C(F)(F)F)[Si](C)(C)C |
| InChI | InChI=1S/C16H24F3NO2Si/c1-5-11-20-13(12-9-7-6-8-10-12)14(23(2,3)4)22-15(21)16(17,18)19/h6-10,13-14,20H,5,11H2,1-4H3/t13-,14-/m1/s1 |
| InChIKey | OFVWNWAIBFQRFD-ZIAGYGMSSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|