C16H20F3NO3 — CID 15953650
ethyl (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate (PubChem CID 15953650) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is ethyl (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate.
| Compound Name | ethyl (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate |
|---|---|
| PubChem CID | 15953650 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl (2S)-2-[[(1R)-2-hydroxy-1-phenylethyl]amino]-2-(trifluoromethyl)pent-4-enoate |
| SMILES | C=CC[C@](N[C@@H](CO)c1ccccc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO3/c1-3-10-15(16(17,18)19,14(22)23-4-2)20-13(11-21)12-8-6-5-7-9-12/h3,5-9,13,20-21H,1,4,10-11H2,2H3/t13-,15-/m0/s1 |
| InChIKey | DCHOOIXBVAXAJG-ZFWWWQNUSA-N |
| XLogP | 2.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|