C31H47NO5Si — CID 134925042
tert-butyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 134925042) has the molecular formula C31H47NO5Si and a molecular weight of 541.81 g/mol. Its IUPAC name is tert-butyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | tert-butyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 134925042 |
| Molecular Formula | C31H47NO5Si |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | tert-butyl 3-[benzhydryl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC([C@H]1COC(C)(C)O1)N(O[Si](C)(C)C(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H47NO5Si/c1-29(2,3)36-27(33)21-25(26-22-34-31(7,8)35-26)32(37-38(9,10)30(4,5)6)28(23-17-13-11-14-18-23)24-19-15-12-16-20-24/h11-20,25-26,28H,21-22H2,1-10H3/t25?,26-/m1/s1 |
| InChIKey | DGWCDIFSHAIMIA-FXDYGKIASA-N |
| XLogP | 7.27 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|