C37H45NO4Si — CID 11028362
ethyl (3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-(dibenzylamino)-3-hydroxypentanoate (PubChem CID 11028362) has the molecular formula C37H45NO4Si and a molecular weight of 595.86 g/mol. Its IUPAC name is ethyl (3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-(dibenzylamino)-3-hydroxypentanoate.
| Compound Name | ethyl (3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-(dibenzylamino)-3-hydroxypentanoate |
|---|---|
| PubChem CID | 11028362 |
| Molecular Formula | C37H45NO4Si |
| Molecular Weight | 595.86 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | ethyl (3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-(dibenzylamino)-3-hydroxypentanoate |
| SMILES | CCOC(=O)C[C@H](O)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H45NO4Si/c1-5-41-36(40)26-35(39)34(38(27-30-18-10-6-11-19-30)28-31-20-12-7-13-21-31)29-42-43(37(2,3)4,32-22-14-8-15-23-32)33-24-16-9-17-25-33/h6-25,34-35,39H,5,26-29H2,1-4H3/t34-,35+/m1/s1 |
| InChIKey | MGVZXUWJLGUEPY-GPOMZPHUSA-N |
| XLogP | 5.95 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.86 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|