C38H67NO5Si3 — CID 134863630
methyl (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanoate (PubChem CID 134863630) has the molecular formula C38H67NO5Si3 and a molecular weight of 702.21 g/mol. Its IUPAC name is methyl (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanoate.
| Compound Name | methyl (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanoate |
|---|---|
| PubChem CID | 134863630 |
| Molecular Formula | C38H67NO5Si3 |
| Molecular Weight | 702.21 g/mol |
| Exact Mass | 701.43 |
| IUPAC Name | methyl (2S,3S,4S)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-4-(dibenzylamino)pentanoate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C38H67NO5Si3/c1-36(2,3)45(11,12)42-29-32(39(27-30-23-19-17-20-24-30)28-31-25-21-18-22-26-31)33(43-46(13,14)37(4,5)6)34(35(40)41-10)44-47(15,16)38(7,8)9/h17-26,32-34H,27-29H2,1-16H3/t32-,33-,34-/m0/s1 |
| InChIKey | AGDAQUBINMZFAY-AFEGWXKPSA-N |
| XLogP | 10.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.21 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|