C29H43NO3Si — CID 59556954
ethyl 1-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propyl]cyclopropane-1-carboxylate (PubChem CID 59556954) has the molecular formula C29H43NO3Si and a molecular weight of 481.75 g/mol. Its IUPAC name is ethyl 1-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59556954 |
| Molecular Formula | C29H43NO3Si |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | ethyl 1-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)propyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H43NO3Si/c1-8-32-27(31)29(19-20-29)26(33-34(6,7)28(3,4)5)23(2)30(21-24-15-11-9-12-16-24)22-25-17-13-10-14-18-25/h9-18,23,26H,8,19-22H2,1-7H3/t23-,26+/m0/s1 |
| InChIKey | BHZITGUYXDESIE-JYFHCDHNSA-N |
| XLogP | 6.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|