C25H33NO3 — CID 123207124
tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2-hydroxyhex-4-enoate (PubChem CID 123207124) has the molecular formula C25H33NO3 and a molecular weight of 395.54 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2-hydroxyhex-4-enoate.
| Compound Name | tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2-hydroxyhex-4-enoate |
|---|---|
| PubChem CID | 123207124 |
| Molecular Formula | C25H33NO3 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | tert-butyl (2R,3R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-2-hydroxyhex-4-enoate |
| SMILES | CC=C[C@H]([C@@H](O)C(=O)OC(C)(C)C)N(Cc1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H33NO3/c1-6-13-22(23(27)24(28)29-25(3,4)5)26(18-20-14-9-7-10-15-20)19(2)21-16-11-8-12-17-21/h6-17,19,22-23,27H,18H2,1-5H3/t19-,22-,23-/m1/s1 |
| InChIKey | UQLLWLBQRSQUDT-UEVCKROQSA-N |
| XLogP | 4.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|