C27H39NO3Si — CID 10434085
(2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol (PubChem CID 10434085) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is (2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol.
| Compound Name | (2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 10434085 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (2S,3S)-1-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol |
| SMILES | C=C=C(OC)[C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H39NO3Si/c1-8-25(30-5)26(29)24(21-31-32(6,7)27(2,3)4)28(19-22-15-11-9-12-16-22)20-23-17-13-10-14-18-23/h9-18,24,26,29H,1,19-21H2,2-7H3/t24-,26-/m0/s1 |
| InChIKey | VPMGBSAEBCMOAI-AHWVRZQESA-N |
| XLogP | 5.76 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|