C20H23NO2 — CID 14965639
1-(dibenzylamino)-3-methoxypenta-3,4-dien-2-ol (PubChem CID 14965639) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(dibenzylamino)-3-methoxypenta-3,4-dien-2-ol.
| Compound Name | 1-(dibenzylamino)-3-methoxypenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 14965639 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(dibenzylamino)-3-methoxypenta-3,4-dien-2-ol |
| SMILES | C=C=C(OC)C(O)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-3-20(23-2)19(22)16-21(14-17-10-6-4-7-11-17)15-18-12-8-5-9-13-18/h4-13,19,22H,1,14-16H2,2H3 |
| InChIKey | MNOPMLRIGPHWAN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|