C19H23NO2 — CID 11748506
(E,2R,3R)-3-[benzyl(methyl)amino]-5-phenylpent-4-ene-1,2-diol (PubChem CID 11748506) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (E,2R,3R)-3-[benzyl(methyl)amino]-5-phenylpent-4-ene-1,2-diol.
| Compound Name | (E,2R,3R)-3-[benzyl(methyl)amino]-5-phenylpent-4-ene-1,2-diol |
|---|---|
| PubChem CID | 11748506 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (E,2R,3R)-3-[benzyl(methyl)amino]-5-phenylpent-4-ene-1,2-diol |
| SMILES | CN(Cc1ccccc1)[C@H](/C=C/c1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C19H23NO2/c1-20(14-17-10-6-3-7-11-17)18(19(22)15-21)13-12-16-8-4-2-5-9-16/h2-13,18-19,21-22H,14-15H2,1H3/b13-12+/t18-,19+/m1/s1 |
| InChIKey | RDCYMRGSPVLBRV-VUDPSUQNSA-N |
| XLogP | 2.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |